C8H12O2 — CID 163761587
(3aR,6aR)-3-methyl-6-methylidene-2,3,3a,6a-tetrahydrofuro[3,2-b]furan (PubChem CID 163761587) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (3aR,6aR)-3-methyl-6-methylidene-2,3,3a,6a-tetrahydrofuro[3,2-b]furan.
| Compound Name | (3aR,6aR)-3-methyl-6-methylidene-2,3,3a,6a-tetrahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 163761587 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (3aR,6aR)-3-methyl-6-methylidene-2,3,3a,6a-tetrahydrofuro[3,2-b]furan |
| SMILES | C=C1CO[C@@H]2C(C)CO[C@H]12 |
| InChI | InChI=1S/C8H12O2/c1-5-3-9-8-6(2)4-10-7(5)8/h6-8H,1,3-4H2,2H3/t6?,7-,8-/m1/s1 |
| InChIKey | LYQBJAFSCSNASL-SPDVFEMOSA-N |
| XLogP | 0.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|