C46H29N5O — CID 163761982
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylcarbazol-9-yl)phenyl]-1,3-benzoxazole (PubChem CID 163761982) has the molecular formula C46H29N5O and a molecular weight of 667.77 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylcarbazol-9-yl)phenyl]-1,3-benzoxazole.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylcarbazol-9-yl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 163761982 |
| Molecular Formula | C46H29N5O |
| Molecular Weight | 667.77 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylcarbazol-9-yl)phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2ccc3c4ccccc4n(-c4ccc(-c5nc6ccccc6o5)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)cc1 |
| InChI | InChI=1S/C46H29N5O/c1-4-14-30(15-5-1)33-24-26-36-35-20-10-12-22-39(35)51(41(36)29-33)40-27-25-34(46-47-38-21-11-13-23-42(38)52-46)28-37(40)45-49-43(31-16-6-2-7-17-31)48-44(50-45)32-18-8-3-9-19-32/h1-29H |
| InChIKey | LYYMVXWXHHUFKY-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.77 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |