C25H28N4O5 — CID 163762141
1-benzoyl-N-[(2S)-1-[[3-(benzylamino)-2,3-dioxopropyl]amino]-1-oxopropan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 163762141) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-benzoyl-N-[(2S)-1-[[3-(benzylamino)-2,3-dioxopropyl]amino]-1-oxopropan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-benzoyl-N-[(2S)-1-[[3-(benzylamino)-2,3-dioxopropyl]amino]-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163762141 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-benzoyl-N-[(2S)-1-[[3-(benzylamino)-2,3-dioxopropyl]amino]-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](NC(=O)C1CCCN1C(=O)c1ccccc1)C(=O)NCC(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H28N4O5/c1-17(22(31)27-16-21(30)24(33)26-15-18-9-4-2-5-10-18)28-23(32)20-13-8-14-29(20)25(34)19-11-6-3-7-12-19/h2-7,9-12,17,20H,8,13-16H2,1H3,(H,26,33)(H,27,31)(H,28,32)/t17-,20?/m0/s1 |
| InChIKey | LZBSRQLSKBGRLB-DIMJTDRSSA-N |
| XLogP | 0.80 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|