C12H15N — CID 163762239
(4Z,6Z)-N-prop-2-enylnona-1,4,6,8-tetraen-3-imine (PubChem CID 163762239) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (4Z,6Z)-N-prop-2-enylnona-1,4,6,8-tetraen-3-imine.
| Compound Name | (4Z,6Z)-N-prop-2-enylnona-1,4,6,8-tetraen-3-imine |
|---|---|
| PubChem CID | 163762239 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (4Z,6Z)-N-prop-2-enylnona-1,4,6,8-tetraen-3-imine |
| SMILES | C=C/C=C\C=C/C(C=C)=N/CC=C |
| InChI | InChI=1S/C12H15N/c1-4-7-8-9-10-12(6-3)13-11-5-2/h4-10H,1-3,11H2/b8-7-,10-9-,13-12+ |
| InChIKey | LZDXBXUCCHRAAU-TXVMBKEHSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|