C11H17N3 — CID 163762822
N-methyl-1-(4-methyl-1,2,4a,5,6,7-hexahydroquinazolin-6-yl)methanimine (PubChem CID 163762822) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-1,2,4a,5,6,7-hexahydroquinazolin-6-yl)methanimine.
| Compound Name | N-methyl-1-(4-methyl-1,2,4a,5,6,7-hexahydroquinazolin-6-yl)methanimine |
|---|---|
| PubChem CID | 163762822 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-methyl-1-(4-methyl-1,2,4a,5,6,7-hexahydroquinazolin-6-yl)methanimine |
| SMILES | C/N=C/C1CC=C2NCN=C(C)C2C1 |
| InChI | InChI=1S/C11H17N3/c1-8-10-5-9(6-12-2)3-4-11(10)14-7-13-8/h4,6,9-10,14H,3,5,7H2,1-2H3/b12-6+ |
| InChIKey | LZRBJJFCGBZTFQ-WUXMJOGZSA-N |
| XLogP | 1.62 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|