C30H31N5O3 — CID 163763107
4-[7-[3-cyano-4-(1-propan-2-ylazetidin-3-yl)oxyphenyl]furo[3,2-b]pyridin-2-yl]-3-methoxy-N,N-dimethylbenzenecarboximidamide (PubChem CID 163763107) has the molecular formula C30H31N5O3 and a molecular weight of 509.61 g/mol. Its IUPAC name is 4-[7-[3-cyano-4-(1-propan-2-ylazetidin-3-yl)oxyphenyl]furo[3,2-b]pyridin-2-yl]-3-methoxy-N,N-dimethylbenzenecarboximidamide.
| Compound Name | 4-[7-[3-cyano-4-(1-propan-2-ylazetidin-3-yl)oxyphenyl]furo[3,2-b]pyridin-2-yl]-3-methoxy-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 163763107 |
| Molecular Formula | C30H31N5O3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 4-[7-[3-cyano-4-(1-propan-2-ylazetidin-3-yl)oxyphenyl]furo[3,2-b]pyridin-2-yl]-3-methoxy-N,N-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(-c2cc3nccc(-c4ccc(OC5CN(C(C)C)C5)c(C#N)c4)c3o2)c(OC)c1)N(C)C |
| InChI | InChI=1S/C30H31N5O3/c1-18(2)35-16-22(17-35)37-26-9-7-19(12-21(26)15-31)23-10-11-33-25-14-28(38-29(23)25)24-8-6-20(13-27(24)36-5)30(32)34(3)4/h6-14,18,22,32H,16-17H2,1-5H3/b32-30- |
| InChIKey | LZXPVXFYSJZNHV-GCUVURNUSA-N |
| XLogP | 5.40 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|