About 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one
3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one (PubChem CID 163764084) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one |
| PubChem CID | 163764084 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one |
| SMILES | CCn1nc(C)c2c(c1=O)CCC2 |
| InChI | InChI=1S/C10H14N2O/c1-3-12-10(13)9-6-4-5-8(9)7(2)11-12/h3-6H2,1-2H3 |
| InChIKey | MASPSVWMVBRXAC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one?
The IUPAC name of 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one (CID 163764084) is 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one.
What is the SMILES notation for 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one?
The canonical SMILES for 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one is CCn1nc(C)c2c(c1=O)CCC2.
What is the InChIKey of 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one?
The InChIKey is MASPSVWMVBRXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-3-12-10(13)9-6-4-5-8(9)7(2)11-12/h3-6H2,1-2H3.
What are the key properties of 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one?
3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one has a molecular weight of 178.23 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-6,7-dihydro-5H-cyclopenta[d]pyridazin-4-one is sourced from PubChem (CID 163764084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).