C12H15F3O3 — CID 163764964
methoxy-[3-methyl-4-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methanol (PubChem CID 163764964) has the molecular formula C12H15F3O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is methoxy-[3-methyl-4-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methanol.
| Compound Name | methoxy-[3-methyl-4-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methanol |
|---|---|
| PubChem CID | 163764964 |
| Molecular Formula | C12H15F3O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | methoxy-[3-methyl-4-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methanol |
| SMILES | COC(O)c1ccc(O[C@@H](C)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C12H15F3O3/c1-7-6-9(11(16)17-3)4-5-10(7)18-8(2)12(13,14)15/h4-6,8,11,16H,1-3H3/t8-,11?/m0/s1 |
| InChIKey | MBLPJUIIFUFIIH-YMNIQAILSA-N |
| XLogP | 2.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|