About ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate
ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate (PubChem CID 163765041) has the molecular formula C12H13F3O3
and a molecular weight of 262.23 g/mol. Its IUPAC name is ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate |
| PubChem CID | 163765041 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H13F3O3/c1-2-18-11(17)7-10(16)8-3-5-9(6-4-8)12(13,14)15/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | MBNGPPYKADQAJP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate?
The IUPAC name of ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate (CID 163765041) is ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate.
What is the SMILES notation for ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate?
The canonical SMILES for ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate is CCOC(=O)CC(=O)C1=CC=C(C(F)(F)F)CC1.
What is the InChIKey of ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate?
The InChIKey is MBNGPPYKADQAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O3/c1-2-18-11(17)7-10(16)8-3-5-9(6-4-8)12(13,14)15/h3,5H,2,4,6-7H2,1H3.
What are the key properties of ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate?
ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate has a molecular weight of 262.23 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxo-3-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propanoate is sourced from PubChem (CID 163765041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).