C12H13NO6 — CID 163765172
methyl (2Z)-2-[(2-aminophenyl)methylidene]-4,4,4-trihydroxy-3-oxobutanoate (PubChem CID 163765172) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is methyl (2Z)-2-[(2-aminophenyl)methylidene]-4,4,4-trihydroxy-3-oxobutanoate.
| Compound Name | methyl (2Z)-2-[(2-aminophenyl)methylidene]-4,4,4-trihydroxy-3-oxobutanoate |
|---|---|
| PubChem CID | 163765172 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | methyl (2Z)-2-[(2-aminophenyl)methylidene]-4,4,4-trihydroxy-3-oxobutanoate |
| SMILES | COC(=O)/C(=C\c1ccccc1N)C(=O)C(O)(O)O |
| InChI | InChI=1S/C12H13NO6/c1-19-11(15)8(10(14)12(16,17)18)6-7-4-2-3-5-9(7)13/h2-6,16-18H,13H2,1H3/b8-6- |
| InChIKey | MBQIYSOYGWMRJJ-VURMDHGXSA-N |
| XLogP | -0.98 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|