About 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid
3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 163765279) has the molecular formula C12H15N4O2+
and a molecular weight of 247.28 g/mol. Its IUPAC name is 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid |
| PubChem CID | 163765279 |
| Molecular Formula | C12H15N4O2+ |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | CC1N=CC=NC1c1cc[n+](CCC(=O)O)nc1 |
| InChI | InChI=1S/C12H14N4O2/c1-9-12(14-5-4-13-9)10-2-6-16(15-8-10)7-3-11(17)18/h2,4-6,8-9,12H,3,7H2,1H3/p+1 |
| InChIKey | MBSPPJALGDWVEV-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid?
The IUPAC name of 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid (CID 163765279) is 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid?
The canonical SMILES for 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid is CC1N=CC=NC1c1cc[n+](CCC(=O)O)nc1.
What is the InChIKey of 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid?
The InChIKey is MBSPPJALGDWVEV-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H14N4O2/c1-9-12(14-5-4-13-9)10-2-6-16(15-8-10)7-3-11(17)18/h2,4-6,8-9,12H,3,7H2,1H3/p+1.
What are the key properties of 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid?
3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid has a molecular weight of 247.28 g/mol, XLogP of 0.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-methyl-2,3-dihydropyrazin-2-yl)pyridazin-1-ium-1-yl]propanoic acid is sourced from PubChem (CID 163765279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).