C25H29N3O2 — CID 163765321
6-[4-[(3-phenylazepan-1-yl)methyl]phenoxy]-2,3-dihydropyridine-3-carboxamide (PubChem CID 163765321) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 6-[4-[(3-phenylazepan-1-yl)methyl]phenoxy]-2,3-dihydropyridine-3-carboxamide.
| Compound Name | 6-[4-[(3-phenylazepan-1-yl)methyl]phenoxy]-2,3-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 163765321 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 6-[4-[(3-phenylazepan-1-yl)methyl]phenoxy]-2,3-dihydropyridine-3-carboxamide |
| SMILES | NC(=O)C1C=CC(Oc2ccc(CN3CCCCC(c4ccccc4)C3)cc2)=NC1 |
| InChI | InChI=1S/C25H29N3O2/c26-25(29)21-11-14-24(27-16-21)30-23-12-9-19(10-13-23)17-28-15-5-4-8-22(18-28)20-6-2-1-3-7-20/h1-3,6-7,9-14,21-22H,4-5,8,15-18H2,(H2,26,29) |
| InChIKey | MBTSQVFBQLVSHQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |