C19H32O2 — CID 163765408
(4S,5aR,9aR,11aS)-4,9a,11a-trimethyl-1,2,3,3a,3b,4,5,5a,7,8,9,9b,10,11-tetradecahydroindeno[5,4-f]chromen-7-ol (PubChem CID 163765408) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (4S,5aR,9aR,11aS)-4,9a,11a-trimethyl-1,2,3,3a,3b,4,5,5a,7,8,9,9b,10,11-tetradecahydroindeno[5,4-f]chromen-7-ol.
| Compound Name | (4S,5aR,9aR,11aS)-4,9a,11a-trimethyl-1,2,3,3a,3b,4,5,5a,7,8,9,9b,10,11-tetradecahydroindeno[5,4-f]chromen-7-ol |
|---|---|
| PubChem CID | 163765408 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (4S,5aR,9aR,11aS)-4,9a,11a-trimethyl-1,2,3,3a,3b,4,5,5a,7,8,9,9b,10,11-tetradecahydroindeno[5,4-f]chromen-7-ol |
| SMILES | CC1C[C@H]2OC(O)CC[C@]2(C)C2CC[C@]3(C)CCCC3C12 |
| InChI | InChI=1S/C19H32O2/c1-12-11-15-19(3,10-7-16(20)21-15)14-6-9-18(2)8-4-5-13(18)17(12)14/h12-17,20H,4-11H2,1-3H3/t12?,13?,14?,15-,16?,17?,18+,19-/m1/s1 |
| InChIKey | MBVLYLBQELPNRR-JZAJCLCZSA-N |
| XLogP | 4.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |