C15H14 — CID 163765454
(2Z,4Z,6Z,8Z,10E)-bicyclo[9.2.2]pentadeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 163765454) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is (2Z,4Z,6Z,8Z,10E)-bicyclo[9.2.2]pentadeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | (2Z,4Z,6Z,8Z,10E)-bicyclo[9.2.2]pentadeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 163765454 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (2Z,4Z,6Z,8Z,10E)-bicyclo[9.2.2]pentadeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | C1=C/C2=C\C=C/C=C\C=C/C=C\C1=CC2 |
| InChI | InChI=1S/C15H14/c1-2-4-6-8-14-10-12-15(13-11-14)9-7-5-3-1/h1-12H,13H2/b3-1-,4-2-,7-5-,8-6-,15-9+ |
| InChIKey | MBWKWHBVCXSRPD-VRBSJLRHSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |