C12H26NO2- — CID 163765825
3-ethyl-N-methoxy-2,3,4-trimethyl-N-oxidohexan-2-amine (PubChem CID 163765825) has the molecular formula C12H26NO2- and a molecular weight of 216.34 g/mol. Its IUPAC name is 3-ethyl-N-methoxy-2,3,4-trimethyl-N-oxidohexan-2-amine.
| Compound Name | 3-ethyl-N-methoxy-2,3,4-trimethyl-N-oxidohexan-2-amine |
|---|---|
| PubChem CID | 163765825 |
| Molecular Formula | C12H26NO2- |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 3-ethyl-N-methoxy-2,3,4-trimethyl-N-oxidohexan-2-amine |
| SMILES | CCC(C)C(C)(CC)C(C)(C)N([O-])OC |
| InChI | InChI=1S/C12H26NO2/c1-8-10(3)12(6,9-2)11(4,5)13(14)15-7/h10H,8-9H2,1-7H3/q-1 |
| InChIKey | NCPGILVYWMRZNU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|