C22H29FO5 — CID 163765874
(9R,16R,17R)-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-5,6,7,8,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthrene-3,11-dione (PubChem CID 163765874) has the molecular formula C22H29FO5 and a molecular weight of 392.47 g/mol. Its IUPAC name is (9R,16R,17R)-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-5,6,7,8,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (9R,16R,17R)-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-5,6,7,8,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 163765874 |
| Molecular Formula | C22H29FO5 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (9R,16R,17R)-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-5,6,7,8,12,14,15,16-octahydro-4H-cyclopenta[a]phenanthrene-3,11-dione |
| SMILES | C[C@@H]1CC2C3CCC4CC(=O)C=CC4(C)[C@@]3(F)C(=O)CC2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,12-13,15-16,24,28H,4-5,8-11H2,1-3H3/t12-,13?,15?,16?,19?,20?,21+,22+/m1/s1 |
| InChIKey | MCFSIARLEWZLQB-QFFICQGCSA-N |
| XLogP | 2.18 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |