C17H22BN3O4 — CID 163765947
[(E)-2-(1-benzofuran-3-yl)-1-(3-piperazin-1-ylpropanoylamino)ethenyl]boronic acid (PubChem CID 163765947) has the molecular formula C17H22BN3O4 and a molecular weight of 343.19 g/mol. Its IUPAC name is [(E)-2-(1-benzofuran-3-yl)-1-(3-piperazin-1-ylpropanoylamino)ethenyl]boronic acid.
| Compound Name | [(E)-2-(1-benzofuran-3-yl)-1-(3-piperazin-1-ylpropanoylamino)ethenyl]boronic acid |
|---|---|
| PubChem CID | 163765947 |
| Molecular Formula | C17H22BN3O4 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | [(E)-2-(1-benzofuran-3-yl)-1-(3-piperazin-1-ylpropanoylamino)ethenyl]boronic acid |
| SMILES | O=C(CCN1CCNCC1)N/C(=C/c1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C17H22BN3O4/c22-17(5-8-21-9-6-19-7-10-21)20-16(18(23)24)11-13-12-25-15-4-2-1-3-14(13)15/h1-4,11-12,19,23-24H,5-10H2,(H,20,22)/b16-11+ |
| InChIKey | MCHDOBVQFYRTQL-LFIBNONCSA-N |
| XLogP | 0.20 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|