C31H2F12N6 — CID 163766431
(1E,2Z)-1,2-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-5-(4-cyano-2,3,5,6-tetrafluorophenyl)spiro[2.2]pentane-5-carbonitrile (PubChem CID 163766431) has the molecular formula C31H2F12N6 and a molecular weight of 686.37 g/mol. Its IUPAC name is (1E,2Z)-1,2-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-5-(4-cyano-2,3,5,6-tetrafluorophenyl)spiro[2.2]pentane-5-carbonitrile.
| Compound Name | (1E,2Z)-1,2-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-5-(4-cyano-2,3,5,6-tetrafluorophenyl)spiro[2.2]pentane-5-carbonitrile |
|---|---|
| PubChem CID | 163766431 |
| Molecular Formula | C31H2F12N6 |
| Molecular Weight | 686.37 g/mol |
| Exact Mass | 686.01 |
| IUPAC Name | (1E,2Z)-1,2-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-5-(4-cyano-2,3,5,6-tetrafluorophenyl)spiro[2.2]pentane-5-carbonitrile |
| SMILES | N#C/C(=C1C(=C(\C#N)c2c(F)c(F)c(C#N)c(F)c2F)\C\12CC2(C#N)c1c(F)c(F)c(C#N)c(F)c1F)c1c(F)c(F)c(C#N)c(F)c1F |
| InChI | InChI=1S/C31H2F12N6/c32-18-10(3-46)19(33)25(39)13(24(18)38)8(1-44)15-16(9(2-45)14-26(40)20(34)11(4-47)21(35)27(14)41)31(15)6-30(31,7-49)17-28(42)22(36)12(5-48)23(37)29(17)43/h6H2/b15-8-,16-9+ |
| InChIKey | MCRLGBLKJLFBOC-IZKYPSLPSA-N |
| XLogP | 7.09 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.37 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|