C20H8N12 — CID 163767458
17-(aziridin-2-yl)-1-methyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-3,5,7,9,11,13,15,17-octaene-4,5,10,11,16-pentacarbonitrile (PubChem CID 163767458) has the molecular formula C20H8N12 and a molecular weight of 416.37 g/mol. Its IUPAC name is 17-(aziridin-2-yl)-1-methyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-3,5,7,9,11,13,15,17-octaene-4,5,10,11,16-pentacarbonitrile.
| Compound Name | 17-(aziridin-2-yl)-1-methyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-3,5,7,9,11,13,15,17-octaene-4,5,10,11,16-pentacarbonitrile |
|---|---|
| PubChem CID | 163767458 |
| Molecular Formula | C20H8N12 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 17-(aziridin-2-yl)-1-methyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-3,5,7,9,11,13,15,17-octaene-4,5,10,11,16-pentacarbonitrile |
| SMILES | CC12N=C(C3CN3)C(C#N)=NC1=c1nc(C#N)c(C#N)nc1=C1N=C(C#N)C(C#N)=NC12 |
| InChI | InChI=1S/C20H8N12/c1-20-18-16(29-10(4-23)11(5-24)30-18)15-17(28-9(3-22)8(2-21)27-15)19(20)31-12(6-25)14(32-20)13-7-26-13/h13,18,26H,7H2,1H3 |
| InChIKey | MDPDXOFVIBYAAQ-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 216.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|