C16H22O3 — CID 163768083
2,3-dimethoxy-5-methyl-4-methylidene-6-[(E)-3-methylpent-2-enyl]cyclohexa-2,5-dien-1-one (PubChem CID 163768083) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-4-methylidene-6-[(E)-3-methylpent-2-enyl]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,3-dimethoxy-5-methyl-4-methylidene-6-[(E)-3-methylpent-2-enyl]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 163768083 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-4-methylidene-6-[(E)-3-methylpent-2-enyl]cyclohexa-2,5-dien-1-one |
| SMILES | C=C1C(C)=C(C/C=C(\C)CC)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C16H22O3/c1-7-10(2)8-9-13-11(3)12(4)15(18-5)16(19-6)14(13)17/h8H,4,7,9H2,1-3,5-6H3/b10-8+ |
| InChIKey | MEBRDJGFVXKRMP-CSKARUKUSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|