C18H25NO4 — CID 163768174
(4aR,10aS)-4a-ethyl-2,5-dihydroxy-6-methoxy-10-(methylamino)-1,2,4,9,10,10a-hexahydrophenanthren-3-one (PubChem CID 163768174) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (4aR,10aS)-4a-ethyl-2,5-dihydroxy-6-methoxy-10-(methylamino)-1,2,4,9,10,10a-hexahydrophenanthren-3-one.
| Compound Name | (4aR,10aS)-4a-ethyl-2,5-dihydroxy-6-methoxy-10-(methylamino)-1,2,4,9,10,10a-hexahydrophenanthren-3-one |
|---|---|
| PubChem CID | 163768174 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (4aR,10aS)-4a-ethyl-2,5-dihydroxy-6-methoxy-10-(methylamino)-1,2,4,9,10,10a-hexahydrophenanthren-3-one |
| SMILES | CC[C@@]12CC(=O)C(O)C[C@@H]1C(NC)Cc1ccc(OC)c(O)c12 |
| InChI | InChI=1S/C18H25NO4/c1-4-18-9-14(21)13(20)8-11(18)12(19-2)7-10-5-6-15(23-3)17(22)16(10)18/h5-6,11-13,19-20,22H,4,7-9H2,1-3H3/t11-,12?,13?,18-/m1/s1 |
| InChIKey | MEDKVZBKFCHSDU-LIVFGMFJSA-N |
| XLogP | 1.53 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |