C11H20N6 — CID 163768656
6-imino-8-N'-methyl-7,8a-dihydro-2H-naphthalene-1,1,3,8,8-pentamine (PubChem CID 163768656) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is 6-imino-8-N'-methyl-7,8a-dihydro-2H-naphthalene-1,1,3,8,8-pentamine.
| Compound Name | 6-imino-8-N'-methyl-7,8a-dihydro-2H-naphthalene-1,1,3,8,8-pentamine |
|---|---|
| PubChem CID | 163768656 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 6-imino-8-N'-methyl-7,8a-dihydro-2H-naphthalene-1,1,3,8,8-pentamine |
| SMILES | [H]/N=C1\C=C2C=C(N)CC(N)(N)C2C(N)(NC)C1 |
| InChI | InChI=1S/C11H20N6/c1-17-11(16)5-8(13)3-6-2-7(12)4-10(14,15)9(6)11/h2-3,9,13,17H,4-5,12,14-16H2,1H3/b13-8+ |
| InChIKey | MENQTMLEWRWABG-MDWZMJQESA-N |
| XLogP | -1.31 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|