C33H31N5O — CID 163770703
(2S)-13-benzyl-2,10-dimethyl-14-[(4-phenylphenyl)methyl]-1,8,10,13,15-pentazapentacyclo[7.7.0.02,7.05,7.012,16]hexadeca-8,12(16),14-trien-11-one (PubChem CID 163770703) has the molecular formula C33H31N5O and a molecular weight of 513.65 g/mol. Its IUPAC name is (2S)-13-benzyl-2,10-dimethyl-14-[(4-phenylphenyl)methyl]-1,8,10,13,15-pentazapentacyclo[7.7.0.02,7.05,7.012,16]hexadeca-8,12(16),14-trien-11-one.
| Compound Name | (2S)-13-benzyl-2,10-dimethyl-14-[(4-phenylphenyl)methyl]-1,8,10,13,15-pentazapentacyclo[7.7.0.02,7.05,7.012,16]hexadeca-8,12(16),14-trien-11-one |
|---|---|
| PubChem CID | 163770703 |
| Molecular Formula | C33H31N5O |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (2S)-13-benzyl-2,10-dimethyl-14-[(4-phenylphenyl)methyl]-1,8,10,13,15-pentazapentacyclo[7.7.0.02,7.05,7.012,16]hexadeca-8,12(16),14-trien-11-one |
| SMILES | CN1C(=O)c2c(nc(Cc3ccc(-c4ccccc4)cc3)n2Cc2ccccc2)N2C1=NC13CC1CC[C@]23C |
| InChI | InChI=1S/C33H31N5O/c1-32-18-17-26-20-33(26,32)35-31-36(2)30(39)28-29(38(31)32)34-27(37(28)21-23-9-5-3-6-10-23)19-22-13-15-25(16-14-22)24-11-7-4-8-12-24/h3-16,26H,17-21H2,1-2H3/t26?,32-,33?/m0/s1 |
| InChIKey | MGDXKZKAEQRSAP-KUSSWHHFSA-N |
| XLogP | 5.76 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |