C24H40O3 — CID 163771828
1-[[(8S)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]oxy]ethyl 4,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 163771828) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 1-[[(8S)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]oxy]ethyl 4,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 1-[[(8S)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]oxy]ethyl 4,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 163771828 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 1-[[(8S)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]oxy]ethyl 4,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(OC(=O)C(CC(C)(C)C)C(C)C)OC1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C24H40O3/c1-13(2)19(12-24(4,5)6)23(25)27-14(3)26-20-11-17-10-18(20)22-16-8-7-15(9-16)21(17)22/h13-22H,7-12H2,1-6H3 |
| InChIKey | MHCKRMJMRRCNFJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|