C27H37F3NO6P — CID 163772210
[2-amino-4-[4-[3-(4-cyclohexa-1,3-dien-1-ylcyclohex-3-en-1-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 163772210) has the molecular formula C27H37F3NO6P and a molecular weight of 559.56 g/mol. Its IUPAC name is [2-amino-4-[4-[3-(4-cyclohexa-1,3-dien-1-ylcyclohex-3-en-1-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[4-[3-(4-cyclohexa-1,3-dien-1-ylcyclohex-3-en-1-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 163772210 |
| Molecular Formula | C27H37F3NO6P |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | [2-amino-4-[4-[3-(4-cyclohexa-1,3-dien-1-ylcyclohex-3-en-1-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | NC(CO)(CCc1ccc(OCCCC2CC=C(C3=CC=CCC3)CC2)c(C(F)(F)F)c1)COP(=O)(O)O |
| InChI | InChI=1S/C27H37F3NO6P/c28-27(29,30)24-17-21(14-15-26(31,18-32)19-37-38(33,34)35)10-13-25(24)36-16-4-5-20-8-11-23(12-9-20)22-6-2-1-3-7-22/h1-2,6,10-11,13,17,20,32H,3-5,7-9,12,14-16,18-19,31H2,(H2,33,34,35) |
| InChIKey | MHKDIQASAFEMIM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|