C58H38F6N2 — CID 163772307
4-[9-[4-(10-phenylanthracen-9-yl)phenyl]carbazol-3-yl]-N-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-N-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 163772307) has the molecular formula C58H38F6N2 and a molecular weight of 876.94 g/mol. Its IUPAC name is 4-[9-[4-(10-phenylanthracen-9-yl)phenyl]carbazol-3-yl]-N-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-N-[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | 4-[9-[4-(10-phenylanthracen-9-yl)phenyl]carbazol-3-yl]-N-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-N-[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 163772307 |
| Molecular Formula | C58H38F6N2 |
| Molecular Weight | 876.94 g/mol |
| Exact Mass | 876.29 |
| IUPAC Name | 4-[9-[4-(10-phenylanthracen-9-yl)phenyl]carbazol-3-yl]-N-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-N-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | FC(F)(F)C1=CCC(N(c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3ccc(-c4c5ccccc5c(-c5ccccc5)c5ccccc45)cc3)cc2)c2ccc(C(F)(F)F)cc2)C=C1 |
| InChI | InChI=1S/C58H38F6N2/c59-57(60,61)41-23-31-44(32-24-41)65(45-33-25-42(26-34-45)58(62,63)64)43-27-18-37(19-28-43)40-22-35-54-52(36-40)47-12-8-9-17-53(47)66(54)46-29-20-39(21-30-46)56-50-15-6-4-13-48(50)55(38-10-2-1-3-11-38)49-14-5-7-16-51(49)56/h1-33,35-36,45H,34H2 |
| InChIKey | MHMROVFRNOHEGP-UHFFFAOYSA-N |
| XLogP | 17.07 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.94 |
| LogP ≤ 5 | 17.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|