C25H36O6 — CID 163773253
(1S,2S,4S,7S,8S,11S,14R,15R,18R)-18-(1,1-dihydroxyethyl)-4-hydroxy-15-[(1S)-1-hydroxyethyl]-4,8,13,16-tetramethyl-10-oxapentacyclo[13.2.1.02,14.03,12.07,11]octadeca-12,16-dien-9-one (PubChem CID 163773253) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (1S,2S,4S,7S,8S,11S,14R,15R,18R)-18-(1,1-dihydroxyethyl)-4-hydroxy-15-[(1S)-1-hydroxyethyl]-4,8,13,16-tetramethyl-10-oxapentacyclo[13.2.1.02,14.03,12.07,11]octadeca-12,16-dien-9-one.
| Compound Name | (1S,2S,4S,7S,8S,11S,14R,15R,18R)-18-(1,1-dihydroxyethyl)-4-hydroxy-15-[(1S)-1-hydroxyethyl]-4,8,13,16-tetramethyl-10-oxapentacyclo[13.2.1.02,14.03,12.07,11]octadeca-12,16-dien-9-one |
|---|---|
| PubChem CID | 163773253 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (1S,2S,4S,7S,8S,11S,14R,15R,18R)-18-(1,1-dihydroxyethyl)-4-hydroxy-15-[(1S)-1-hydroxyethyl]-4,8,13,16-tetramethyl-10-oxapentacyclo[13.2.1.02,14.03,12.07,11]octadeca-12,16-dien-9-one |
| SMILES | CC1=C[C@@H]2[C@@H]3C4C(=C(C)[C@@H]3[C@@]1([C@H](C)O)[C@@H]2C(C)(O)O)[C@H]1OC(=O)[C@@H](C)[C@@H]1CC[C@]4(C)O |
| InChI | InChI=1S/C25H36O6/c1-10-9-15-17-18(25(10,13(4)26)21(15)24(6,29)30)12(3)16-19(17)23(5,28)8-7-14-11(2)22(27)31-20(14)16/h9,11,13-15,17-21,26,28-30H,7-8H2,1-6H3/t11-,13-,14-,15+,17-,18-,19?,20-,21-,23-,25+/m0/s1 |
| InChIKey | MIFMMBLBKOVODP-YFFMSNHTSA-N |
| XLogP | 2.16 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|