C47H43N3S — CID 163773538
9-[6-(4,11b-dimethyl-4,4a,6b,10a-tetrahydro-3H-naphtho[1,2-b][1]benzothiol-8-yl)-3-methyl-4-phenyl-2,4-dihydro-1H-pyrimidin-2-yl]-2-phenylcarbazole (PubChem CID 163773538) has the molecular formula C47H43N3S and a molecular weight of 681.95 g/mol. Its IUPAC name is 9-[6-(4,11b-dimethyl-4,4a,6b,10a-tetrahydro-3H-naphtho[1,2-b][1]benzothiol-8-yl)-3-methyl-4-phenyl-2,4-dihydro-1H-pyrimidin-2-yl]-2-phenylcarbazole.
| Compound Name | 9-[6-(4,11b-dimethyl-4,4a,6b,10a-tetrahydro-3H-naphtho[1,2-b][1]benzothiol-8-yl)-3-methyl-4-phenyl-2,4-dihydro-1H-pyrimidin-2-yl]-2-phenylcarbazole |
|---|---|
| PubChem CID | 163773538 |
| Molecular Formula | C47H43N3S |
| Molecular Weight | 681.95 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | 9-[6-(4,11b-dimethyl-4,4a,6b,10a-tetrahydro-3H-naphtho[1,2-b][1]benzothiol-8-yl)-3-methyl-4-phenyl-2,4-dihydro-1H-pyrimidin-2-yl]-2-phenylcarbazole |
| SMILES | CC1CC=CC2(C)C3=C(C=CC12)C1C=C(C2=CC(c4ccccc4)N(C)C(n4c5ccccc5c5ccc(-c6ccccc6)cc54)N2)C=CC1S3 |
| InChI | InChI=1S/C47H43N3S/c1-30-13-12-26-47(2)39(30)24-23-37-38-27-34(21-25-44(38)51-45(37)47)40-29-42(32-16-8-5-9-17-32)49(3)46(48-40)50-41-19-11-10-18-35(41)36-22-20-33(28-43(36)50)31-14-6-4-7-15-31/h4-12,14-30,38-39,42,44,46,48H,13H2,1-3H3 |
| InChIKey | MILLNTGBIRWWFS-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.95 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|