About 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one
5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one (PubChem CID 163773701) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one.
Molecular Properties
| Compound Name | 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one |
| PubChem CID | 163773701 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one |
| SMILES | CN(C)C1=NC(=O)CSC1(C)C |
| InChI | InChI=1S/C8H14N2OS/c1-8(2)7(10(3)4)9-6(11)5-12-8/h5H2,1-4H3 |
| InChIKey | MIOTUOKNDUBLHH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one?
The IUPAC name of 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one (CID 163773701) is 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one.
What is the SMILES notation for 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one?
The canonical SMILES for 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one is CN(C)C1=NC(=O)CSC1(C)C.
What is the InChIKey of 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one?
The InChIKey is MIOTUOKNDUBLHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2OS/c1-8(2)7(10(3)4)9-6(11)5-12-8/h5H2,1-4H3.
What are the key properties of 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one?
5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one has a molecular weight of 186.28 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-6,6-dimethyl-1,4-thiazin-3-one is sourced from PubChem (CID 163773701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).