C23H28FN7O2S — CID 163773859
N-(aminomethylidene)-N'-[4-[[6-[(8-cyclopropylsulfanyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-5-methoxypyrimidin-4-yl]amino]-3-fluorophenyl]methanimidamide (PubChem CID 163773859) has the molecular formula C23H28FN7O2S and a molecular weight of 485.59 g/mol. Its IUPAC name is N-(aminomethylidene)-N'-[4-[[6-[(8-cyclopropylsulfanyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-5-methoxypyrimidin-4-yl]amino]-3-fluorophenyl]methanimidamide.
| Compound Name | N-(aminomethylidene)-N'-[4-[[6-[(8-cyclopropylsulfanyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-5-methoxypyrimidin-4-yl]amino]-3-fluorophenyl]methanimidamide |
|---|---|
| PubChem CID | 163773859 |
| Molecular Formula | C23H28FN7O2S |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-(aminomethylidene)-N'-[4-[[6-[(8-cyclopropylsulfanyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-5-methoxypyrimidin-4-yl]amino]-3-fluorophenyl]methanimidamide |
| SMILES | COc1c(Nc2ccc(/N=C/N=C/N)cc2F)ncnc1OC1CC2CCC(C1)N2SC1CC1 |
| InChI | InChI=1S/C23H28FN7O2S/c1-32-21-22(30-20-7-2-14(8-19(20)24)27-12-26-11-25)28-13-29-23(21)33-17-9-15-3-4-16(10-17)31(15)34-18-5-6-18/h2,7-8,11-13,15-18H,3-6,9-10H2,1H3,(H2,25,26,27)(H,28,29,30) |
| InChIKey | MISICVSGIKPFFE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|