About N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide
N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide (PubChem CID 163774163) has the molecular formula C14H12ClF3N4O2
and a molecular weight of 360.72 g/mol. Its IUPAC name is N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide.
Molecular Properties
| Compound Name | N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide |
| PubChem CID | 163774163 |
| Molecular Formula | C14H12ClF3N4O2 |
| Molecular Weight | 360.72 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide |
| SMILES | C=COc1cncc(-n2cc(NC(=O)CCC(F)(F)F)c(Cl)n2)c1 |
| InChI | InChI=1S/C14H12ClF3N4O2/c1-2-24-10-5-9(6-19-7-10)22-8-11(13(15)21-22)20-12(23)3-4-14(16,17)18/h2,5-8H,1,3-4H2,(H,20,23) |
| InChIKey | MIYZFQNJJXBFQV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide?
The IUPAC name of N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide (CID 163774163) is N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide.
What is the SMILES notation for N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide?
The canonical SMILES for N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide is C=COc1cncc(-n2cc(NC(=O)CCC(F)(F)F)c(Cl)n2)c1.
What is the InChIKey of N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide?
The InChIKey is MIYZFQNJJXBFQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClF3N4O2/c1-2-24-10-5-9(6-19-7-10)22-8-11(13(15)21-22)20-12(23)3-4-14(16,17)18/h2,5-8H,1,3-4H2,(H,20,23).
What are the key properties of N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide?
N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide has a molecular weight of 360.72 g/mol, XLogP of 3.72, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-1-(5-ethenoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide is sourced from PubChem (CID 163774163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).