C22H38FNO — CID 163774221
N-[(Z,5R)-5-fluoro-2-methylhept-3-enyl]-4,4-dimethyl-5-(3-methylbutyl)cyclohexene-1-carboxamide (PubChem CID 163774221) has the molecular formula C22H38FNO and a molecular weight of 351.55 g/mol. Its IUPAC name is N-[(Z,5R)-5-fluoro-2-methylhept-3-enyl]-4,4-dimethyl-5-(3-methylbutyl)cyclohexene-1-carboxamide.
| Compound Name | N-[(Z,5R)-5-fluoro-2-methylhept-3-enyl]-4,4-dimethyl-5-(3-methylbutyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 163774221 |
| Molecular Formula | C22H38FNO |
| Molecular Weight | 351.55 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | N-[(Z,5R)-5-fluoro-2-methylhept-3-enyl]-4,4-dimethyl-5-(3-methylbutyl)cyclohexene-1-carboxamide |
| SMILES | CC[C@@H](F)/C=C\C(C)CNC(=O)C1=CCC(C)(C)C(CCC(C)C)C1 |
| InChI | InChI=1S/C22H38FNO/c1-7-20(23)11-9-17(4)15-24-21(25)18-12-13-22(5,6)19(14-18)10-8-16(2)3/h9,11-12,16-17,19-20H,7-8,10,13-15H2,1-6H3,(H,24,25)/b11-9-/t17?,19?,20-/m1/s1 |
| InChIKey | MJABYYHUKKNRKZ-GGSBTVNPSA-N |
| XLogP | 5.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|