C18H27N3 — CID 163775217
2-(6,6-dimethyl-4a,5-dihydrobenzo[7]annulen-4-yl)-1,1,3,3-tetramethylguanidine (PubChem CID 163775217) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-(6,6-dimethyl-4a,5-dihydrobenzo[7]annulen-4-yl)-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-(6,6-dimethyl-4a,5-dihydrobenzo[7]annulen-4-yl)-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 163775217 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-(6,6-dimethyl-4a,5-dihydrobenzo[7]annulen-4-yl)-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NC1=CC=CC2=CC=CC(C)(C)CC21)N(C)C |
| InChI | InChI=1S/C18H27N3/c1-18(2)12-8-10-14-9-7-11-16(15(14)13-18)19-17(20(3)4)21(5)6/h7-12,15H,13H2,1-6H3 |
| InChIKey | MJVJPFHUZFHNLQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|