About 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one
3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one (PubChem CID 163775535) has the molecular formula C14H16F2N2O
and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one.
Molecular Properties
| Compound Name | 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one |
| PubChem CID | 163775535 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one |
| SMILES | CC(C)C(C)Cn1cnc2cc(F)c(F)cc2c1=O |
| InChI | InChI=1S/C14H16F2N2O/c1-8(2)9(3)6-18-7-17-13-5-12(16)11(15)4-10(13)14(18)19/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | MKCDUYYPNWVRKX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one?
The IUPAC name of 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one (CID 163775535) is 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one.
What is the SMILES notation for 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one?
The canonical SMILES for 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one is CC(C)C(C)Cn1cnc2cc(F)c(F)cc2c1=O.
What is the InChIKey of 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one?
The InChIKey is MKCDUYYPNWVRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N2O/c1-8(2)9(3)6-18-7-17-13-5-12(16)11(15)4-10(13)14(18)19/h4-5,7-9H,6H2,1-3H3.
What are the key properties of 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one?
3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one has a molecular weight of 266.29 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylbutyl)-6,7-difluoroquinazolin-4-one is sourced from PubChem (CID 163775535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).