C10H9BF2O6 — CID 163775569
7-(2,2-difluoroethoxy)-2-hydroxy-3H-1,4,2-benzodioxaborinine-8-carboxylic acid (PubChem CID 163775569) has the molecular formula C10H9BF2O6 and a molecular weight of 273.98 g/mol. Its IUPAC name is 7-(2,2-difluoroethoxy)-2-hydroxy-3H-1,4,2-benzodioxaborinine-8-carboxylic acid.
| Compound Name | 7-(2,2-difluoroethoxy)-2-hydroxy-3H-1,4,2-benzodioxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 163775569 |
| Molecular Formula | C10H9BF2O6 |
| Molecular Weight | 273.98 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 7-(2,2-difluoroethoxy)-2-hydroxy-3H-1,4,2-benzodioxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1c(OCC(F)F)ccc2c1OB(O)CO2 |
| InChI | InChI=1S/C10H9BF2O6/c12-7(13)3-17-5-1-2-6-9(8(5)10(14)15)19-11(16)4-18-6/h1-2,7,16H,3-4H2,(H,14,15) |
| InChIKey | MKCYIUQRJQEQJD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.98 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|