C9H10N2 — CID 163775786
7-methyl-4a,8a-dihydrocinnoline (PubChem CID 163775786) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 7-methyl-4a,8a-dihydrocinnoline.
| Compound Name | 7-methyl-4a,8a-dihydrocinnoline |
|---|---|
| PubChem CID | 163775786 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 7-methyl-4a,8a-dihydrocinnoline |
| SMILES | CC1=CC2N=NC=CC2C=C1 |
| InChI | InChI=1S/C9H10N2/c1-7-2-3-8-4-5-10-11-9(8)6-7/h2-6,8-9H,1H3 |
| InChIKey | MKIDLNQUJQQOLU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |