C39H38Si2 — CID 163775866
trimethyl-[2-(10-phenylanthracen-2-yl)-9-trimethylsilylfluoren-9-yl]silane (PubChem CID 163775866) has the molecular formula C39H38Si2 and a molecular weight of 562.91 g/mol. Its IUPAC name is trimethyl-[2-(10-phenylanthracen-2-yl)-9-trimethylsilylfluoren-9-yl]silane.
| Compound Name | trimethyl-[2-(10-phenylanthracen-2-yl)-9-trimethylsilylfluoren-9-yl]silane |
|---|---|
| PubChem CID | 163775866 |
| Molecular Formula | C39H38Si2 |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | trimethyl-[2-(10-phenylanthracen-2-yl)-9-trimethylsilylfluoren-9-yl]silane |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)c2ccccc2-c2ccc(-c3ccc4c(-c5ccccc5)c5ccccc5cc4c3)cc21 |
| InChI | InChI=1S/C39H38Si2/c1-40(2,3)39(41(4,5)6)36-19-13-12-18-34(36)35-23-21-29(26-37(35)39)28-20-22-33-31(24-28)25-30-16-10-11-17-32(30)38(33)27-14-8-7-9-15-27/h7-26H,1-6H3 |
| InChIKey | MKKNSHGOWXSPPQ-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|