C22H20F3N3O3 — CID 163776370
3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[(4R,5S)-4-hydroxy-7-oxa-2-azabicyclo[4.1.0]heptan-5-yl]propanamide (PubChem CID 163776370) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[(4R,5S)-4-hydroxy-7-oxa-2-azabicyclo[4.1.0]heptan-5-yl]propanamide.
| Compound Name | 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[(4R,5S)-4-hydroxy-7-oxa-2-azabicyclo[4.1.0]heptan-5-yl]propanamide |
|---|---|
| PubChem CID | 163776370 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-[(4R,5S)-4-hydroxy-7-oxa-2-azabicyclo[4.1.0]heptan-5-yl]propanamide |
| SMILES | O=C(CCc1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12)N[C@@H]1C2OC2NC[C@H]1O |
| InChI | InChI=1S/C22H20F3N3O3/c23-11-3-1-10(2-4-11)18-13(14-7-12(24)8-15(25)19(14)28-18)5-6-17(30)27-20-16(29)9-26-22-21(20)31-22/h1-4,7-8,16,20-22,26,28-29H,5-6,9H2,(H,27,30)/t16-,20+,21?,22?/m1/s1 |
| InChIKey | MKVHMENLNVQUDT-TVVAXXBHSA-N |
| XLogP | 2.36 |
| TPSA | 89.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|