C19H20F3IO3S2 — CID 163776593
ethyl 5-[(4-iodo-3,5-dimethylphenoxy)-(3,3,3-trifluoropropylsulfanyl)methyl]thiophene-2-carboxylate (PubChem CID 163776593) has the molecular formula C19H20F3IO3S2 and a molecular weight of 544.40 g/mol. Its IUPAC name is ethyl 5-[(4-iodo-3,5-dimethylphenoxy)-(3,3,3-trifluoropropylsulfanyl)methyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-[(4-iodo-3,5-dimethylphenoxy)-(3,3,3-trifluoropropylsulfanyl)methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 163776593 |
| Molecular Formula | C19H20F3IO3S2 |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 543.99 |
| IUPAC Name | ethyl 5-[(4-iodo-3,5-dimethylphenoxy)-(3,3,3-trifluoropropylsulfanyl)methyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(Oc2cc(C)c(I)c(C)c2)SCCC(F)(F)F)s1 |
| InChI | InChI=1S/C19H20F3IO3S2/c1-4-25-17(24)14-5-6-15(28-14)18(27-8-7-19(20,21)22)26-13-9-11(2)16(23)12(3)10-13/h5-6,9-10,18H,4,7-8H2,1-3H3 |
| InChIKey | MKZUGLYXRVZCNZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|