C22H32N4O3 — CID 163776662
methyl (2S)-6-[(E)-1-[amino(cyclopropyl)amino]prop-1-en-2-yl]-5-(azetidin-3-ylmethoxy)-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 163776662) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is methyl (2S)-6-[(E)-1-[amino(cyclopropyl)amino]prop-1-en-2-yl]-5-(azetidin-3-ylmethoxy)-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | methyl (2S)-6-[(E)-1-[amino(cyclopropyl)amino]prop-1-en-2-yl]-5-(azetidin-3-ylmethoxy)-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 163776662 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | methyl (2S)-6-[(E)-1-[amino(cyclopropyl)amino]prop-1-en-2-yl]-5-(azetidin-3-ylmethoxy)-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)N1c2ccc(/C(C)=C/N(N)C3CC3)c(OCC3CNC3)c2CC[C@@H]1C |
| InChI | InChI=1S/C22H32N4O3/c1-14(12-25(23)17-5-6-17)18-8-9-20-19(21(18)29-13-16-10-24-11-16)7-4-15(2)26(20)22(27)28-3/h8-9,12,15-17,24H,4-7,10-11,13,23H2,1-3H3/b14-12+/t15-/m0/s1 |
| InChIKey | MLBIGPDOYBDZSI-ZQHYZAEZSA-N |
| XLogP | 2.89 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|