C25H36N6O2 — CID 163777235
(3aS)-1-methyl-5-[4-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one (PubChem CID 163777235) has the molecular formula C25H36N6O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is (3aS)-1-methyl-5-[4-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one.
| Compound Name | (3aS)-1-methyl-5-[4-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 163777235 |
| Molecular Formula | C25H36N6O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (3aS)-1-methyl-5-[4-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
| SMILES | CN1C(=O)C[C@H]2CN(C3CCC(Nc4ncnc5[nH]cc(C6CCOCC6)c45)CC3)CCC21 |
| InChI | InChI=1S/C25H36N6O2/c1-30-21-6-9-31(14-17(21)12-22(30)32)19-4-2-18(3-5-19)29-25-23-20(16-7-10-33-11-8-16)13-26-24(23)27-15-28-25/h13,15-19,21H,2-12,14H2,1H3,(H2,26,27,28,29)/t17-,18?,19?,21?/m0/s1 |
| InChIKey | MLNKSPKBBXWPSG-GGQJKKPXSA-N |
| XLogP | 3.13 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |