C28H23Cl2N3O6 — CID 163777476
4-[2,6-dichloro-4-[(3-hydroxyphenyl)methylcarbamoyl]phenyl]-2-[(3-methyl-1H-indole-2-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 163777476) has the molecular formula C28H23Cl2N3O6 and a molecular weight of 568.41 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-[(3-hydroxyphenyl)methylcarbamoyl]phenyl]-2-[(3-methyl-1H-indole-2-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[2,6-dichloro-4-[(3-hydroxyphenyl)methylcarbamoyl]phenyl]-2-[(3-methyl-1H-indole-2-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163777476 |
| Molecular Formula | C28H23Cl2N3O6 |
| Molecular Weight | 568.41 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | 4-[2,6-dichloro-4-[(3-hydroxyphenyl)methylcarbamoyl]phenyl]-2-[(3-methyl-1H-indole-2-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | Cc1c(C(=O)NC(CC(=O)c2c(Cl)cc(C(=O)NCc3cccc(O)c3)cc2Cl)C(=O)O)[nH]c2ccccc12 |
| InChI | InChI=1S/C28H23Cl2N3O6/c1-14-18-7-2-3-8-21(18)32-25(14)27(37)33-22(28(38)39)12-23(35)24-19(29)10-16(11-20(24)30)26(36)31-13-15-5-4-6-17(34)9-15/h2-11,22,32,34H,12-13H2,1H3,(H,31,36)(H,33,37)(H,38,39) |
| InChIKey | NQAQHBJGRVXYOF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|