C29H19N2O- — CID 163777675
9-(3-dibenzofuran-4-ylphenyl)-1H-pyrido[3,4-b]indol-2-ide (PubChem CID 163777675) has the molecular formula C29H19N2O- and a molecular weight of 411.48 g/mol. Its IUPAC name is 9-(3-dibenzofuran-4-ylphenyl)-1H-pyrido[3,4-b]indol-2-ide.
| Compound Name | 9-(3-dibenzofuran-4-ylphenyl)-1H-pyrido[3,4-b]indol-2-ide |
|---|---|
| PubChem CID | 163777675 |
| Molecular Formula | C29H19N2O- |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 9-(3-dibenzofuran-4-ylphenyl)-1H-pyrido[3,4-b]indol-2-ide |
| SMILES | C1=Cc2c(n(-c3cccc(-c4cccc5c4oc4ccccc45)c3)c3ccccc23)C[N-]1 |
| InChI | InChI=1S/C29H19N2O/c1-3-13-26-22(9-1)23-15-16-30-18-27(23)31(26)20-8-5-7-19(17-20)21-11-6-12-25-24-10-2-4-14-28(24)32-29(21)25/h1-17H,18H2/q-1 |
| InChIKey | MLWRBBKAHLDVPH-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 32.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |