C15H24O2 — CID 163778431
5,5-diethyl-4-(2-hydroxyethyl)-2-prop-2-enylcyclohexa-1,3-dien-1-ol (PubChem CID 163778431) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 5,5-diethyl-4-(2-hydroxyethyl)-2-prop-2-enylcyclohexa-1,3-dien-1-ol.
| Compound Name | 5,5-diethyl-4-(2-hydroxyethyl)-2-prop-2-enylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 163778431 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 5,5-diethyl-4-(2-hydroxyethyl)-2-prop-2-enylcyclohexa-1,3-dien-1-ol |
| SMILES | C=CCC1=C(O)CC(CC)(CC)C(CCO)=C1 |
| InChI | InChI=1S/C15H24O2/c1-4-7-12-10-13(8-9-16)15(5-2,6-3)11-14(12)17/h4,10,16-17H,1,5-9,11H2,2-3H3 |
| InChIKey | MMMWSFGFTOUAAH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|