C8H11NOS — CID 163779360
(8aS)-3,5,6,7,8,8a-hexahydrothiopyrano[3,2-c]pyridin-2-one (PubChem CID 163779360) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is (8aS)-3,5,6,7,8,8a-hexahydrothiopyrano[3,2-c]pyridin-2-one.
| Compound Name | (8aS)-3,5,6,7,8,8a-hexahydrothiopyrano[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 163779360 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | (8aS)-3,5,6,7,8,8a-hexahydrothiopyrano[3,2-c]pyridin-2-one |
| SMILES | O=C1CC=C2CNCC[C@@H]2S1 |
| InChI | InChI=1S/C8H11NOS/c10-8-2-1-6-5-9-4-3-7(6)11-8/h1,7,9H,2-5H2/t7-/m0/s1 |
| InChIKey | MNHQVUWICKWZGD-ZETCQYMHSA-N |
| XLogP | 0.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|