C45H44O4S2 — CID 163779586
5-(4-tert-butylphenyl)-7-[4-[4-[5-[4-(2-methylbutan-2-yl)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]phenyl]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 163779586) has the molecular formula C45H44O4S2 and a molecular weight of 712.98 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-7-[4-[4-[5-[4-(2-methylbutan-2-yl)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]phenyl]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-(4-tert-butylphenyl)-7-[4-[4-[5-[4-(2-methylbutan-2-yl)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]phenyl]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 163779586 |
| Molecular Formula | C45H44O4S2 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | 5-(4-tert-butylphenyl)-7-[4-[4-[5-[4-(2-methylbutan-2-yl)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]phenyl]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCC(C)(C)c1ccc(-c2sc(-c3ccc(-c4ccc(-c5sc(-c6ccc(C(C)(C)C)cc6)c6c5OCCO6)cc4)cc3)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C45H44O4S2/c1-7-45(5,6)35-22-18-33(19-23-35)43-39-37(47-25-27-49-39)41(51-43)31-14-10-29(11-15-31)28-8-12-30(13-9-28)40-36-38(48-26-24-46-36)42(50-40)32-16-20-34(21-17-32)44(2,3)4/h8-23H,7,24-27H2,1-6H3 |
| InChIKey | MNNAYBCUFKKNLW-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |