About tributyl(pyrazin-2-yl)-λ4-sulfane
tributyl(pyrazin-2-yl)-λ4-sulfane (PubChem CID 163779986) has the molecular formula C16H30N2S
and a molecular weight of 282.50 g/mol. Its IUPAC name is tributyl(pyrazin-2-yl)-λ4-sulfane.
Molecular Properties
| Compound Name | tributyl(pyrazin-2-yl)-λ4-sulfane |
| PubChem CID | 163779986 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | tributyl(pyrazin-2-yl)-λ4-sulfane |
| SMILES | CCCCS(CCCC)(CCCC)c1cnccn1 |
| InChI | InChI=1S/C16H30N2S/c1-4-7-12-19(13-8-5-2,14-9-6-3)16-15-17-10-11-18-16/h10-11,15H,4-9,12-14H2,1-3H3 |
| InChIKey | MNUUDAUPARHZGW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tributyl(pyrazin-2-yl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(pyrazin-2-yl)-λ4-sulfane?
The IUPAC name of tributyl(pyrazin-2-yl)-λ4-sulfane (CID 163779986) is tributyl(pyrazin-2-yl)-λ4-sulfane.
What is the SMILES notation for tributyl(pyrazin-2-yl)-λ4-sulfane?
The canonical SMILES for tributyl(pyrazin-2-yl)-λ4-sulfane is CCCCS(CCCC)(CCCC)c1cnccn1.
What is the InChIKey of tributyl(pyrazin-2-yl)-λ4-sulfane?
The InChIKey is MNUUDAUPARHZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2S/c1-4-7-12-19(13-8-5-2,14-9-6-3)16-15-17-10-11-18-16/h10-11,15H,4-9,12-14H2,1-3H3.
What are the key properties of tributyl(pyrazin-2-yl)-λ4-sulfane?
tributyl(pyrazin-2-yl)-λ4-sulfane has a molecular weight of 282.50 g/mol, XLogP of 5.04, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(pyrazin-2-yl)-λ4-sulfane is sourced from PubChem (CID 163779986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).