About CID 163780212
CID 163780212 (PubChem CID 163780212) has the molecular formula C12H10I2NO4-
and a molecular weight of 486.02 g/mol.
Molecular Properties
| Compound Name | CID 163780212 |
| PubChem CID | 163780212 |
| Molecular Formula | C12H10I2NO4- |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.87 |
| IUPAC Name | — |
| SMILES | CC(I)(C(=O)Oc1ccc2c(c1)COC2=O)C1N[I-]1 |
| InChI | InChI=1S/C12H10I2NO4/c1-12(13,10-14-15-10)11(17)19-7-2-3-8-6(4-7)5-18-9(8)16/h2-4,10,15H,5H2,1H3/q-1 |
| InChIKey | IHRNFNXQWVQCPL-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 163780212 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163780212?
The IUPAC name of CID 163780212 (CID 163780212) is not available.
What is the SMILES notation for CID 163780212?
The canonical SMILES for CID 163780212 is CC(I)(C(=O)Oc1ccc2c(c1)COC2=O)C1N[I-]1.
What is the InChIKey of CID 163780212?
The InChIKey is IHRNFNXQWVQCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10I2NO4/c1-12(13,10-14-15-10)11(17)19-7-2-3-8-6(4-7)5-18-9(8)16/h2-4,10,15H,5H2,1H3/q-1.
What are the key properties of CID 163780212?
CID 163780212 has a molecular weight of 486.02 g/mol, XLogP of -1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163780212 is sourced from PubChem (CID 163780212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).