C9H12N2S — CID 163780430
7-ethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine (PubChem CID 163780430) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 7-ethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine.
| Compound Name | 7-ethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine |
|---|---|
| PubChem CID | 163780430 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 7-ethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine |
| SMILES | CCc1cnc2c(c1)NCCS2 |
| InChI | InChI=1S/C9H12N2S/c1-2-7-5-8-9(11-6-7)12-4-3-10-8/h5-6,10H,2-4H2,1H3 |
| InChIKey | MOCSKOUNKWRZGA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |