About 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane
2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane (PubChem CID 163781563) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane.
Molecular Properties
| Compound Name | 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane |
| PubChem CID | 163781563 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane |
| SMILES | Cc1ccc(C2(C3CCC3)NCC(C)CN2)cc1 |
| InChI | InChI=1S/C16H24N2/c1-12-6-8-15(9-7-12)16(14-4-3-5-14)17-10-13(2)11-18-16/h6-9,13-14,17-18H,3-5,10-11H2,1-2H3 |
| InChIKey | MOZWTXJIRJZUDK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane?
The IUPAC name of 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane (CID 163781563) is 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane.
What is the SMILES notation for 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane?
The canonical SMILES for 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane is Cc1ccc(C2(C3CCC3)NCC(C)CN2)cc1.
What is the InChIKey of 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane?
The InChIKey is MOZWTXJIRJZUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-12-6-8-15(9-7-12)16(14-4-3-5-14)17-10-13(2)11-18-16/h6-9,13-14,17-18H,3-5,10-11H2,1-2H3.
What are the key properties of 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane?
2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane has a molecular weight of 244.38 g/mol, XLogP of 2.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-5-methyl-2-(4-methylphenyl)-1,3-diazinane is sourced from PubChem (CID 163781563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).